C19H27F3N2O5S — CID 155865502
2-[[(3aS,5R,7aS)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155865502) has the molecular formula C19H27F3N2O5S and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-[[(3aS,5R,7aS)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(3aS,5R,7aS)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155865502 |
| Molecular Formula | C19H27F3N2O5S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-[[(3aS,5R,7aS)-1-(thiophen-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)COC[C@H]1CC[C@H]2[C@H](CCN2Cc2ccsc2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O3S.C2HF3O2/c1-18(2)17(20)11-21-10-14-3-4-15-16(22-14)5-7-19(15)9-13-6-8-23-12-13;3-2(4,5)1(6)7/h6,8,12,14-16H,3-5,7,9-11H2,1-2H3;(H,6,7)/t14-,15+,16+;/m1./s1 |
| InChIKey | MMIIIRMMHMSFNG-BZSDZJHCSA-N |
| XLogP | 2.61 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |