C19H25F6N3O5S — CID 155852536
2-[(3aS,6aR)-1-(thiophen-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155852536) has the molecular formula C19H25F6N3O5S and a molecular weight of 521.48 g/mol. Its IUPAC name is 2-[(3aS,6aR)-1-(thiophen-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(3aS,6aR)-1-(thiophen-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155852536 |
| Molecular Formula | C19H25F6N3O5S |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2-[(3aS,6aR)-1-(thiophen-3-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C(=O)CN1CC[C@@H]2[C@@H]1CCN2Cc1ccsc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3OS.2C2HF3O2/c1-16(2)15(19)10-18-7-4-13-14(18)3-6-17(13)9-12-5-8-20-11-12;2*3-2(4,5)1(6)7/h5,8,11,13-14H,3-4,6-7,9-10H2,1-2H3;2*(H,6,7)/t13-,14+;;/m1../s1 |
| InChIKey | HTHNCRKOVKQGSV-BQFBZIMZSA-N |
| XLogP | 2.75 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |