C12H18N2OS — CID 94087258
N,N-dimethyl-2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]acetamide (PubChem CID 94087258) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 94087258 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N,N-dimethyl-2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]acetamide |
| SMILES | CN(C)C(=O)CN1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C12H18N2OS/c1-13(2)12(15)8-14-6-3-4-11(14)10-5-7-16-9-10/h5,7,9,11H,3-4,6,8H2,1-2H3/t11-/m1/s1 |
| InChIKey | AVOXRFVPJAIWSD-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |