C19H22FN3O2S — CID 47035121
3-(4-fluoro-N-[2-(2-thiophen-3-ylpyrrolidin-1-yl)acetyl]anilino)propanamide (PubChem CID 47035121) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-(4-fluoro-N-[2-(2-thiophen-3-ylpyrrolidin-1-yl)acetyl]anilino)propanamide.
| Compound Name | 3-(4-fluoro-N-[2-(2-thiophen-3-ylpyrrolidin-1-yl)acetyl]anilino)propanamide |
|---|---|
| PubChem CID | 47035121 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-(4-fluoro-N-[2-(2-thiophen-3-ylpyrrolidin-1-yl)acetyl]anilino)propanamide |
| SMILES | NC(=O)CCN(C(=O)CN1CCCC1c1ccsc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FN3O2S/c20-15-3-5-16(6-4-15)23(10-7-18(21)24)19(25)12-22-9-1-2-17(22)14-8-11-26-13-14/h3-6,8,11,13,17H,1-2,7,9-10,12H2,(H2,21,24) |
| InChIKey | XNPZNRXBOWXRGS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |