C20H28F6N2O6S — CID 155825657
(4R,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(thiophen-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155825657) has the molecular formula C20H28F6N2O6S and a molecular weight of 538.51 g/mol. Its IUPAC name is (4R,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(thiophen-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4R,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(thiophen-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155825657 |
| Molecular Formula | C20H28F6N2O6S |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (4R,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(thiophen-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1C[C@H]2[C@@H](C1)N(Cc1ccsc1)CC[C@H]2OC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N2O2S.2C2HF3O2/c1-19-7-6-17-10-14-15(11-17)18(5-3-16(14)20-2)9-13-4-8-21-12-13;2*3-2(4,5)1(6)7/h4,8,12,14-16H,3,5-7,9-11H2,1-2H3;2*(H,6,7)/t14-,15+,16+;;/m0../s1 |
| InChIKey | PUDGOFAUYVOGFV-MTJVOZGJSA-N |
| XLogP | 3.18 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |