C16H26N2O3 — CID 97477513
(4R,4aS,7aS)-1-(furan-3-ylmethyl)-4-methoxy-6-(2-methoxyethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 97477513) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is (4R,4aS,7aS)-1-(furan-3-ylmethyl)-4-methoxy-6-(2-methoxyethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | (4R,4aS,7aS)-1-(furan-3-ylmethyl)-4-methoxy-6-(2-methoxyethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 97477513 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (4R,4aS,7aS)-1-(furan-3-ylmethyl)-4-methoxy-6-(2-methoxyethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | COCCN1C[C@H]2[C@@H](C1)N(Cc1ccoc1)CC[C@H]2OC |
| InChI | InChI=1S/C16H26N2O3/c1-19-8-6-17-10-14-15(11-17)18(5-3-16(14)20-2)9-13-4-7-21-12-13/h4,7,12,14-16H,3,5-6,8-11H2,1-2H3/t14-,15+,16+/m0/s1 |
| InChIKey | PBOXMQFQZLQLBT-ARFHVFGLSA-N |
| XLogP | 1.45 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |