C19H27NO5 — CID 134690207
furan-2-yl-[(5S)-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methanone (PubChem CID 134690207) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is furan-2-yl-[(5S)-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methanone.
| Compound Name | furan-2-yl-[(5S)-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 134690207 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | furan-2-yl-[(5S)-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCC2O[C@H](COCC3CCOCC3)CCC21 |
| InChI | InChI=1S/C19H27NO5/c21-19(18-2-1-9-24-18)20-8-5-17-16(20)4-3-15(25-17)13-23-12-14-6-10-22-11-7-14/h1-2,9,14-17H,3-8,10-13H2/t15-,16?,17?/m0/s1 |
| InChIKey | ULRQJUGYPBNUSL-GTPINHCMSA-N |
| XLogP | 2.48 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |