C15H27NO5S — CID 97387213
(3aS,5R,7aS)-1-methylsulfonyl-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97387213) has the molecular formula C15H27NO5S and a molecular weight of 333.45 g/mol. Its IUPAC name is (3aS,5R,7aS)-1-methylsulfonyl-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aS,5R,7aS)-1-methylsulfonyl-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97387213 |
| Molecular Formula | C15H27NO5S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3aS,5R,7aS)-1-methylsulfonyl-5-(oxan-4-ylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | CS(=O)(=O)N1CC[C@@H]2O[C@@H](COCC3CCOCC3)CC[C@@H]21 |
| InChI | InChI=1S/C15H27NO5S/c1-22(17,18)16-7-4-15-14(16)3-2-13(21-15)11-20-10-12-5-8-19-9-6-12/h12-15H,2-11H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | APVIWPOYFYOKMB-ILXRZTDVSA-N |
| XLogP | 1.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |