C18H31F3N2O6S — CID 155826520
(3aS,5R,7aS)-5-[(1-methylpiperidin-4-yl)methoxymethyl]-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155826520) has the molecular formula C18H31F3N2O6S and a molecular weight of 460.52 g/mol. Its IUPAC name is (3aS,5R,7aS)-5-[(1-methylpiperidin-4-yl)methoxymethyl]-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,5R,7aS)-5-[(1-methylpiperidin-4-yl)methoxymethyl]-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826520 |
| Molecular Formula | C18H31F3N2O6S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (3aS,5R,7aS)-5-[(1-methylpiperidin-4-yl)methoxymethyl]-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCC(COC[C@H]2CC[C@H]3[C@H](CCN3S(C)(=O)=O)O2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H30N2O4S.C2HF3O2/c1-17-8-5-13(6-9-17)11-21-12-14-3-4-15-16(22-14)7-10-18(15)23(2,19)20;3-2(4,5)1(6)7/h13-16H,3-12H2,1-2H3;(H,6,7)/t14-,15+,16+;/m1./s1 |
| InChIKey | JSNLNDZEBWBJFI-BZSDZJHCSA-N |
| XLogP | 1.56 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |