C18H25F3N2O6 — CID 155829873
(2S,3aR,6aR)-N-(2-methoxyethyl)-4-[(5-methylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155829873) has the molecular formula C18H25F3N2O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is (2S,3aR,6aR)-N-(2-methoxyethyl)-4-[(5-methylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3aR,6aR)-N-(2-methoxyethyl)-4-[(5-methylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829873 |
| Molecular Formula | C18H25F3N2O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (2S,3aR,6aR)-N-(2-methoxyethyl)-4-[(5-methylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H]2[C@@H](CCN2Cc2ccc(C)o2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O4.C2HF3O2/c1-11-3-4-12(21-11)10-18-7-5-14-13(18)9-15(22-14)16(19)17-6-8-20-2;3-2(4,5)1(6)7/h3-4,13-15H,5-10H2,1-2H3,(H,17,19);(H,6,7)/t13-,14-,15+;/m1./s1 |
| InChIKey | KCEDUNRVRIXBNK-QRWISWEOSA-N |
| XLogP | 1.72 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|