C19H29N3O3 — CID 97458536
(2R,3aS,6aS)-4-[(5-methylfuran-2-yl)methyl]-N-(2-pyrrolidin-1-ylethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide (PubChem CID 97458536) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2R,3aS,6aS)-4-[(5-methylfuran-2-yl)methyl]-N-(2-pyrrolidin-1-ylethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide.
| Compound Name | (2R,3aS,6aS)-4-[(5-methylfuran-2-yl)methyl]-N-(2-pyrrolidin-1-ylethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97458536 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (2R,3aS,6aS)-4-[(5-methylfuran-2-yl)methyl]-N-(2-pyrrolidin-1-ylethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide |
| SMILES | Cc1ccc(CN2CC[C@@H]3O[C@@H](C(=O)NCCN4CCCC4)C[C@@H]32)o1 |
| InChI | InChI=1S/C19H29N3O3/c1-14-4-5-15(24-14)13-22-10-6-17-16(22)12-18(25-17)19(23)20-7-11-21-8-2-3-9-21/h4-5,16-18H,2-3,6-13H2,1H3,(H,20,23)/t16-,17-,18+/m0/s1 |
| InChIKey | UATUKDMVWPAUQS-OKZBNKHCSA-N |
| XLogP | 1.53 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |