C18H25F3N4O4 — CID 171694101
(2R,3aS,6aS)-N-(cyclopropylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171694101) has the molecular formula C18H25F3N4O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is (2R,3aS,6aS)-N-(cyclopropylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,6aS)-N-(cyclopropylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694101 |
| Molecular Formula | C18H25F3N4O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (2R,3aS,6aS)-N-(cyclopropylmethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CN2CC[C@@H]3O[C@@H](C(=O)NCC4CC4)C[C@@H]32)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2.C2HF3O2/c1-19-9-12(8-18-19)10-20-5-4-14-13(20)6-15(22-14)16(21)17-7-11-2-3-11;3-2(4,5)1(6)7/h8-9,11,13-15H,2-7,10H2,1H3,(H,17,21);(H,6,7)/t13-,14-,15+;/m0./s1 |
| InChIKey | GJWSEMIIWZDDAZ-UEHWSTJSSA-N |
| XLogP | 1.31 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |