C19H30N4O2 — CID 124821562
[(3aS,5S,7aS)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 124821562) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is [(3aS,5S,7aS)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [(3aS,5S,7aS)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 124821562 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | [(3aS,5S,7aS)-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)[C@@H]2CC[C@H]3[C@H](CCN3Cc3cnn(C)c3)O2)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-14-5-8-22(9-6-14)19(24)18-4-3-16-17(25-18)7-10-23(16)13-15-11-20-21(2)12-15/h11-12,14,16-18H,3-10,13H2,1-2H3/t16-,17-,18-/m0/s1 |
| InChIKey | XKANXBPUTFHKFL-BZSNNMDCSA-N |
| XLogP | 1.80 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |