C17H24N4O — CID 97459188
[(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-cyclopent-3-en-1-ylmethanone (PubChem CID 97459188) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-cyclopent-3-en-1-ylmethanone.
| Compound Name | [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-cyclopent-3-en-1-ylmethanone |
|---|---|
| PubChem CID | 97459188 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-cyclopent-3-en-1-ylmethanone |
| SMILES | Cn1cc(CN2CC[C@@H]3[C@@H]2CCN3C(=O)C2CC=CC2)cn1 |
| InChI | InChI=1S/C17H24N4O/c1-19-11-13(10-18-19)12-20-8-6-16-15(20)7-9-21(16)17(22)14-4-2-3-5-14/h2-3,10-11,14-16H,4-9,12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | HNFREUADNCNYPB-JKSUJKDBSA-N |
| XLogP | 1.56 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|