C16H20N4O2 — CID 97459164
[(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(furan-2-yl)methanone (PubChem CID 97459164) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(furan-2-yl)methanone.
| Compound Name | [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 97459164 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(furan-2-yl)methanone |
| SMILES | Cn1cc(CN2CC[C@@H]3[C@@H]2CCN3C(=O)c2ccco2)cn1 |
| InChI | InChI=1S/C16H20N4O2/c1-18-10-12(9-17-18)11-19-6-4-14-13(19)5-7-20(14)16(21)15-3-2-8-22-15/h2-3,8-10,13-14H,4-7,11H2,1H3/t13-,14+/m0/s1 |
| InChIKey | JVTWPOJPTTUDJX-UONOGXRCSA-N |
| XLogP | 1.50 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |