C14H22N4 — CID 124816025
(3aS,6aR)-4-[(1-methylpyrazol-4-yl)methyl]-1-prop-2-enyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 124816025) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is (3aS,6aR)-4-[(1-methylpyrazol-4-yl)methyl]-1-prop-2-enyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aS,6aR)-4-[(1-methylpyrazol-4-yl)methyl]-1-prop-2-enyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 124816025 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (3aS,6aR)-4-[(1-methylpyrazol-4-yl)methyl]-1-prop-2-enyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | C=CCN1CC[C@H]2[C@H]1CCN2Cc1cnn(C)c1 |
| InChI | InChI=1S/C14H22N4/c1-3-6-17-7-4-14-13(17)5-8-18(14)11-12-9-15-16(2)10-12/h3,9-10,13-14H,1,4-8,11H2,2H3/t13-,14+/m1/s1 |
| InChIKey | HOBGTZSDKOBYRW-KGLIPLIRSA-N |
| XLogP | 1.25 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|