C18H21F3N4O3S — CID 155827705
[(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155827705) has the molecular formula C18H21F3N4O3S and a molecular weight of 430.45 g/mol. Its IUPAC name is [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827705 |
| Molecular Formula | C18H21F3N4O3S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [(3aR,6aS)-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CN2CC[C@@H]3[C@@H]2CCN3C(=O)c2ccsc2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N4OS.C2HF3O2/c1-18-9-12(8-17-18)10-19-5-2-15-14(19)3-6-20(15)16(21)13-4-7-22-11-13;3-2(4,5)1(6)7/h4,7-9,11,14-15H,2-3,5-6,10H2,1H3;(H,6,7)/t14-,15+;/m0./s1 |
| InChIKey | ISZZSYMOXAHUPB-LDXVYITESA-N |
| XLogP | 2.60 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |