C10H10N2O2 — CID 62717295
1-(furan-2-yl)-2-(1-methylpyrazol-4-yl)ethanone (PubChem CID 62717295) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-(1-methylpyrazol-4-yl)ethanone.
| Compound Name | 1-(furan-2-yl)-2-(1-methylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 62717295 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(furan-2-yl)-2-(1-methylpyrazol-4-yl)ethanone |
| SMILES | Cn1cc(CC(=O)c2ccco2)cn1 |
| InChI | InChI=1S/C10H10N2O2/c1-12-7-8(6-11-12)5-9(13)10-3-2-4-14-10/h2-4,6-7H,5H2,1H3 |
| InChIKey | RHANFPAHMXIGBL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |