C18H24N4O3 — CID 131638971
N-[[4-[(1-methylpyrazol-4-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide (PubChem CID 131638971) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[[4-[(1-methylpyrazol-4-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[4-[(1-methylpyrazol-4-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 131638971 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[[4-[(1-methylpyrazol-4-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide |
| SMILES | Cn1cc(CN2CCOC3C(CNC(=O)c4ccco4)CCC32)cn1 |
| InChI | InChI=1S/C18H24N4O3/c1-21-11-13(9-20-21)12-22-6-8-25-17-14(4-5-15(17)22)10-19-18(23)16-3-2-7-24-16/h2-3,7,9,11,14-15,17H,4-6,8,10,12H2,1H3,(H,19,23) |
| InChIKey | WGUDOSHJBBSDQT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |