C21H25F3N2O6 — CID 155845078
N-[[4-[(5-methylfuran-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155845078) has the molecular formula C21H25F3N2O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is N-[[4-[(5-methylfuran-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[4-[(5-methylfuran-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845078 |
| Molecular Formula | C21H25F3N2O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[[4-[(5-methylfuran-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCOC3C(CNC(=O)c4ccco4)CCC32)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N2O4.C2HF3O2/c1-13-4-6-15(25-13)12-21-8-10-24-18-14(5-7-16(18)21)11-20-19(22)17-3-2-9-23-17;3-2(4,5)1(6)7/h2-4,6,9,14,16,18H,5,7-8,10-12H2,1H3,(H,20,22);(H,6,7) |
| InChIKey | UDEJPQZJTBIXAF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |