C18H22N2O3S — CID 97378175
N-[[(4aR,7S,7aR)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide (PubChem CID 97378175) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[[(4aR,7S,7aR)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(4aR,7S,7aR)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 97378175 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[[(4aR,7S,7aR)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]furan-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CC[C@@H]2[C@@H]1OCCN2Cc1cccs1)c1ccco1 |
| InChI | InChI=1S/C18H22N2O3S/c21-18(16-4-1-8-22-16)19-11-13-5-6-15-17(13)23-9-7-20(15)12-14-3-2-10-24-14/h1-4,8,10,13,15,17H,5-7,9,11-12H2,(H,19,21)/t13-,15+,17+/m0/s1 |
| InChIKey | QBAAYXVAKDDLOV-YSVLISHTSA-N |
| XLogP | 2.75 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |