C18H22N4O3 — CID 133139594
N-[[(4aR,7aR)-4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridazine-4-carboxamide (PubChem CID 133139594) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[[(4aR,7aR)-4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[(4aR,7aR)-4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 133139594 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[[(4aR,7aR)-4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyridazine-4-carboxamide |
| SMILES | O=C(NCC1CC[C@@H]2[C@@H]1OCCN2Cc1ccco1)c1ccnnc1 |
| InChI | InChI=1S/C18H22N4O3/c23-18(14-5-6-20-21-11-14)19-10-13-3-4-16-17(13)25-9-7-22(16)12-15-2-1-8-24-15/h1-2,5-6,8,11,13,16-17H,3-4,7,9-10,12H2,(H,19,23)/t13?,16-,17-/m1/s1 |
| InChIKey | LIYMSJGEGKMSIB-SYFTWWQRSA-N |
| XLogP | 1.48 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |