C13H18N4O2 — CID 124783276
N-[[(4aR,7S,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazin-7-yl]methyl]pyridazine-4-carboxamide (PubChem CID 124783276) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[[(4aR,7S,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazin-7-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[(4aR,7S,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazin-7-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 124783276 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-[[(4aR,7S,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazin-7-yl]methyl]pyridazine-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CC[C@H]2NCCO[C@@H]12)c1ccnnc1 |
| InChI | InChI=1S/C13H18N4O2/c18-13(10-3-4-16-17-8-10)15-7-9-1-2-11-12(9)19-6-5-14-11/h3-4,8-9,11-12,14H,1-2,5-7H2,(H,15,18)/t9-,11+,12-/m0/s1 |
| InChIKey | ZKNPCGIHNFWAOZ-WCQGTBRESA-N |
| XLogP | -0.03 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |