C16H24N4O — CID 131899772
N-[[1-(3-methylbut-2-enyl)piperidin-4-yl]methyl]pyridazine-4-carboxamide (PubChem CID 131899772) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[[1-(3-methylbut-2-enyl)piperidin-4-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[1-(3-methylbut-2-enyl)piperidin-4-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 131899772 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-[[1-(3-methylbut-2-enyl)piperidin-4-yl]methyl]pyridazine-4-carboxamide |
| SMILES | CC(C)=CCN1CCC(CNC(=O)c2ccnnc2)CC1 |
| InChI | InChI=1S/C16H24N4O/c1-13(2)4-8-20-9-5-14(6-10-20)11-17-16(21)15-3-7-18-19-12-15/h3-4,7,12,14H,5-6,8-11H2,1-2H3,(H,17,21) |
| InChIKey | DXTNMKJTMMIUAQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|