C19H22N4O3 — CID 58933452
benzyl 4-[(pyridazine-4-carbonylamino)methyl]piperidine-1-carboxylate (PubChem CID 58933452) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is benzyl 4-[(pyridazine-4-carbonylamino)methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(pyridazine-4-carbonylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58933452 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | benzyl 4-[(pyridazine-4-carbonylamino)methyl]piperidine-1-carboxylate |
| SMILES | O=C(NCC1CCN(C(=O)OCc2ccccc2)CC1)c1ccnnc1 |
| InChI | InChI=1S/C19H22N4O3/c24-18(17-6-9-21-22-13-17)20-12-15-7-10-23(11-8-15)19(25)26-14-16-4-2-1-3-5-16/h1-6,9,13,15H,7-8,10-12,14H2,(H,20,24) |
| InChIKey | QFJKNECXPGCFAR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |