C20H22ClN3O3 — CID 58933687
benzyl 4-[[(6-chloropyridine-2-carbonyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 58933687) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is benzyl 4-[[(6-chloropyridine-2-carbonyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[(6-chloropyridine-2-carbonyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58933687 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | benzyl 4-[[(6-chloropyridine-2-carbonyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(NCC1CCN(C(=O)OCc2ccccc2)CC1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C20H22ClN3O3/c21-18-8-4-7-17(23-18)19(25)22-13-15-9-11-24(12-10-15)20(26)27-14-16-5-2-1-3-6-16/h1-8,15H,9-14H2,(H,22,25) |
| InChIKey | WJGXLSRRFLJVDI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|