C12H17Cl2N3O — CID 91645277
6-chloro-N-(piperidin-4-ylmethyl)pyridine-2-carboxamide;hydrochloride (PubChem CID 91645277) has the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. Its IUPAC name is 6-chloro-N-(piperidin-4-ylmethyl)pyridine-2-carboxamide;hydrochloride.
| Compound Name | 6-chloro-N-(piperidin-4-ylmethyl)pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 91645277 |
| Molecular Formula | C12H17Cl2N3O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 6-chloro-N-(piperidin-4-ylmethyl)pyridine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCNCC1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C12H16ClN3O.ClH/c13-11-3-1-2-10(16-11)12(17)15-8-9-4-6-14-7-5-9;/h1-3,9,14H,4-8H2,(H,15,17);1H |
| InChIKey | DHSUBNMUOGKHSU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|