C12H17ClN3O- — CID 53312688
N-(piperidin-4-ylmethyl)pyridine-4-carboxamide chloride (PubChem CID 53312688) has the molecular formula C12H17ClN3O- and a molecular weight of 254.74 g/mol. Its IUPAC name is N-(piperidin-4-ylmethyl)pyridine-4-carboxamide chloride.
| Compound Name | N-(piperidin-4-ylmethyl)pyridine-4-carboxamide chloride |
|---|---|
| PubChem CID | 53312688 |
| Molecular Formula | C12H17ClN3O- |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-(piperidin-4-ylmethyl)pyridine-4-carboxamide chloride |
| SMILES | O=C(NCC1CCNCC1)c1ccncc1.[Cl-] |
| InChI | InChI=1S/C12H17N3O.ClH/c16-12(11-3-7-14-8-4-11)15-9-10-1-5-13-6-2-10;/h3-4,7-8,10,13H,1-2,5-6,9H2,(H,15,16);1H/p-1 |
| InChIKey | XYMDSEAFEYXZBF-UHFFFAOYSA-M |
| XLogP | -2.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |