C19H20FN3O2 — CID 121108538
4-fluoro-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]benzamide (PubChem CID 121108538) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 4-fluoro-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 121108538 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-fluoro-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]benzamide |
| SMILES | O=C(NCC1CCN(C(=O)c2ccncc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O2/c20-17-3-1-15(2-4-17)18(24)22-13-14-7-11-23(12-8-14)19(25)16-5-9-21-10-6-16/h1-6,9-10,14H,7-8,11-13H2,(H,22,24) |
| InChIKey | VNQGJGKTJHHQLS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |