C19H28N4O2 — CID 121108676
1-cyclohexyl-3-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]urea (PubChem CID 121108676) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]urea.
| Compound Name | 1-cyclohexyl-3-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]urea |
|---|---|
| PubChem CID | 121108676 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-cyclohexyl-3-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]urea |
| SMILES | O=C(NCC1CCN(C(=O)c2ccncc2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C19H28N4O2/c24-18(16-6-10-20-11-7-16)23-12-8-15(9-13-23)14-21-19(25)22-17-4-2-1-3-5-17/h6-7,10-11,15,17H,1-5,8-9,12-14H2,(H2,21,22,25) |
| InChIKey | GNFBMTXGLPPPQJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |