C20H30N4O2 — CID 121107666
N'-cycloheptyl-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]oxamide (PubChem CID 121107666) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N'-cycloheptyl-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]oxamide.
| Compound Name | N'-cycloheptyl-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 121107666 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N'-cycloheptyl-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]oxamide |
| SMILES | O=C(NCC1CCN(c2ccncc2)CC1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H30N4O2/c25-19(20(26)23-17-5-3-1-2-4-6-17)22-15-16-9-13-24(14-10-16)18-7-11-21-12-8-18/h7-8,11-12,16-17H,1-6,9-10,13-15H2,(H,22,25)(H,23,26) |
| InChIKey | IBFYXDNFYOVIGV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|