C20H21FN4O3 — CID 121107584
N'-(2-fluorophenyl)-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]oxamide (PubChem CID 121107584) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2-fluorophenyl)-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 121107584 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N'-(2-fluorophenyl)-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]oxamide |
| SMILES | O=C(NCC1CCN(C(=O)c2ccncc2)CC1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C20H21FN4O3/c21-16-3-1-2-4-17(16)24-19(27)18(26)23-13-14-7-11-25(12-8-14)20(28)15-5-9-22-10-6-15/h1-6,9-10,14H,7-8,11-13H2,(H,23,26)(H,24,27) |
| InChIKey | QAGVFSVBVBDNGO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|