C20H20FN5O2 — CID 121107742
N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2-fluorophenyl)oxamide (PubChem CID 121107742) has the molecular formula C20H20FN5O2 and a molecular weight of 381.41 g/mol. Its IUPAC name is N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2-fluorophenyl)oxamide.
| Compound Name | N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 121107742 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2-fluorophenyl)oxamide |
| SMILES | N#Cc1cccnc1N1CCC(CNC(=O)C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H20FN5O2/c21-16-5-1-2-6-17(16)25-20(28)19(27)24-13-14-7-10-26(11-8-14)18-15(12-22)4-3-9-23-18/h1-6,9,14H,7-8,10-11,13H2,(H,24,27)(H,25,28) |
| InChIKey | GMUGOHZUQOFQMM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|