C20H22FN5O — CID 121109003
1-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 121109003) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 121109003 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | N#Cc1cccnc1N1CCC(CNC(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22FN5O/c21-18-5-3-15(4-6-18)13-24-20(27)25-14-16-7-10-26(11-8-16)19-17(12-22)2-1-9-23-19/h1-6,9,16H,7-8,10-11,13-14H2,(H2,24,25,27) |
| InChIKey | SQNWWVPGXXFJGI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |