C20H19F2N5O2 — CID 121107759
N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2,4-difluorophenyl)oxamide (PubChem CID 121107759) has the molecular formula C20H19F2N5O2 and a molecular weight of 399.40 g/mol. Its IUPAC name is N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2,4-difluorophenyl)oxamide.
| Compound Name | N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2,4-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 121107759 |
| Molecular Formula | C20H19F2N5O2 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2,4-difluorophenyl)oxamide |
| SMILES | N#Cc1cccnc1N1CCC(CNC(=O)C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C20H19F2N5O2/c21-15-3-4-17(16(22)10-15)26-20(29)19(28)25-12-13-5-8-27(9-6-13)18-14(11-23)2-1-7-24-18/h1-4,7,10,13H,5-6,8-9,12H2,(H,25,28)(H,26,29) |
| InChIKey | BBUHNCIYTAAHGG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|