C22H25N5O4 — CID 121107789
N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(3,4-dimethoxyphenyl)oxamide (PubChem CID 121107789) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(3,4-dimethoxyphenyl)oxamide.
| Compound Name | N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(3,4-dimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 121107789 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(3,4-dimethoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1OC |
| InChI | InChI=1S/C22H25N5O4/c1-30-18-6-5-17(12-19(18)31-2)26-22(29)21(28)25-14-15-7-10-27(11-8-15)20-16(13-23)4-3-9-24-20/h3-6,9,12,15H,7-8,10-11,14H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | USKFBLCRTIDMTA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|