C22H23N5O4 — CID 121107781
N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide (PubChem CID 121107781) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide.
| Compound Name | N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide |
|---|---|
| PubChem CID | 121107781 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide |
| SMILES | N#Cc1cccnc1N1CCC(CNC(=O)C(=O)Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C22H23N5O4/c23-13-16-2-1-7-24-20(16)27-8-5-15(6-9-27)14-25-21(28)22(29)26-17-3-4-18-19(12-17)31-11-10-30-18/h1-4,7,12,15H,5-6,8-11,14H2,(H,25,28)(H,26,29) |
| InChIKey | NITZIWHCUWVDGZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|