C20H23N5O4 — CID 121107855
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide (PubChem CID 121107855) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 121107855 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide |
| SMILES | O=C(NCC1CCN(c2cnccn2)CC1)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H23N5O4/c26-19(20(27)24-15-1-2-16-17(11-15)29-10-9-28-16)23-12-14-3-7-25(8-4-14)18-13-21-5-6-22-18/h1-2,5-6,11,13-14H,3-4,7-10,12H2,(H,23,26)(H,24,27) |
| InChIKey | RKWDRAWOWMRPIV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|