C15H21N5O2 — CID 121107808
N-prop-2-enyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide (PubChem CID 121107808) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-prop-2-enyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide.
| Compound Name | N-prop-2-enyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 121107808 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-prop-2-enyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide |
| SMILES | C=CCNC(=O)C(=O)NCC1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C15H21N5O2/c1-2-5-18-14(21)15(22)19-10-12-3-8-20(9-4-12)13-11-16-6-7-17-13/h2,6-7,11-12H,1,3-5,8-10H2,(H,18,21)(H,19,22) |
| InChIKey | VMSMSXFXQAKAGY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|