C25H28N6O4S2 — CID 121107873
N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-N'-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide (PubChem CID 121107873) has the molecular formula C25H28N6O4S2 and a molecular weight of 540.67 g/mol. Its IUPAC name is N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-N'-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide.
| Compound Name | N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-N'-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide |
|---|---|
| PubChem CID | 121107873 |
| Molecular Formula | C25H28N6O4S2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-N'-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide |
| SMILES | O=C(NCC1CCN(c2cnccn2)CC1)C(=O)Nc1ccc2c(c1)N(S(=O)(=O)c1cccs1)CCC2 |
| InChI | InChI=1S/C25H28N6O4S2/c32-24(28-16-18-7-12-30(13-8-18)22-17-26-9-10-27-22)25(33)29-20-6-5-19-3-1-11-31(21(19)15-20)37(34,35)23-4-2-14-36-23/h2,4-6,9-10,14-15,17-18H,1,3,7-8,11-13,16H2,(H,28,32)(H,29,33) |
| InChIKey | NWXIGFSDRAFFOX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|