C21H23N3O6 — CID 90521977
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]oxamide (PubChem CID 90521977) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 90521977 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]oxamide |
| SMILES | O=C(NCC1CCN(C(=O)c2ccoc2)CC1)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H23N3O6/c25-19(20(26)23-16-1-2-17-18(11-16)30-10-9-29-17)22-12-14-3-6-24(7-4-14)21(27)15-5-8-28-13-15/h1-2,5,8,11,13-14H,3-4,6-7,9-10,12H2,(H,22,25)(H,23,26) |
| InChIKey | AXVCNNKDMXFIKT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|