C15H23N3O3 — CID 90522000
1-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]-3-propylurea (PubChem CID 90522000) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]-3-propylurea.
| Compound Name | 1-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]-3-propylurea |
|---|---|
| PubChem CID | 90522000 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]-3-propylurea |
| SMILES | CCCNC(=O)NCC1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-2-6-16-15(20)17-10-12-3-7-18(8-4-12)14(19)13-5-9-21-11-13/h5,9,11-12H,2-4,6-8,10H2,1H3,(H2,16,17,20) |
| InChIKey | NOIULEJHYXMTSG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |