C20H23N3O4 — CID 90521938
N-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]-N'-(3-methylphenyl)oxamide (PubChem CID 90521938) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]-N'-(3-methylphenyl)oxamide.
| Compound Name | N-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]-N'-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 90521938 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[[1-(furan-3-carbonyl)piperidin-4-yl]methyl]-N'-(3-methylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NCC2CCN(C(=O)c3ccoc3)CC2)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-14-3-2-4-17(11-14)22-19(25)18(24)21-12-15-5-8-23(9-6-15)20(26)16-7-10-27-13-16/h2-4,7,10-11,13,15H,5-6,8-9,12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | GDVONHMBYUCOJP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|