C22H26N4O4 — CID 121107606
N'-(2-methoxy-5-methylphenyl)-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]oxamide (PubChem CID 121107606) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N'-(2-methoxy-5-methylphenyl)-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2-methoxy-5-methylphenyl)-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 121107606 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N'-(2-methoxy-5-methylphenyl)-N-[[1-(pyridine-4-carbonyl)piperidin-4-yl]methyl]oxamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(=O)NCC1CCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C22H26N4O4/c1-15-3-4-19(30-2)18(13-15)25-21(28)20(27)24-14-16-7-11-26(12-8-16)22(29)17-5-9-23-10-6-17/h3-6,9-10,13,16H,7-8,11-12,14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | ZBTCSTZHZOHNIS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|