C22H26N4O5 — CID 90521021
N'-(2,5-dimethoxyphenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]oxamide (PubChem CID 90521021) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is N'-(2,5-dimethoxyphenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2,5-dimethoxyphenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 90521021 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N'-(2,5-dimethoxyphenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]oxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(=O)NCC2CCN(C(=O)c3cccnc3)CC2)c1 |
| InChI | InChI=1S/C22H26N4O5/c1-30-17-5-6-19(31-2)18(12-17)25-21(28)20(27)24-13-15-7-10-26(11-8-15)22(29)16-4-3-9-23-14-16/h3-6,9,12,14-15H,7-8,10-11,13H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | XXRTUISPTJKUJJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|