C21H23N5O5 — CID 90521019
N'-(2-methyl-4-nitrophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]oxamide (PubChem CID 90521019) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is N'-(2-methyl-4-nitrophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2-methyl-4-nitrophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 90521019 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N'-(2-methyl-4-nitrophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]oxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)NCC1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C21H23N5O5/c1-14-11-17(26(30)31)4-5-18(14)24-20(28)19(27)23-12-15-6-9-25(10-7-15)21(29)16-3-2-8-22-13-16/h2-5,8,11,13,15H,6-7,9-10,12H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | XUGRLCMPKZLNSJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|