C21H22N4O5 — CID 3126779
N-[[1-(4-nitrobenzoyl)piperidin-4-yl]methyl]-N'-phenyloxamide (PubChem CID 3126779) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-[[1-(4-nitrobenzoyl)piperidin-4-yl]methyl]-N'-phenyloxamide.
| Compound Name | N-[[1-(4-nitrobenzoyl)piperidin-4-yl]methyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 3126779 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[[1-(4-nitrobenzoyl)piperidin-4-yl]methyl]-N'-phenyloxamide |
| SMILES | O=C(NCC1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H22N4O5/c26-19(20(27)23-17-4-2-1-3-5-17)22-14-15-10-12-24(13-11-15)21(28)16-6-8-18(9-7-16)25(29)30/h1-9,15H,10-14H2,(H,22,26)(H,23,27) |
| InChIKey | JBNKWZALIFLPMA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|