C19H26N4O4S — CID 121109828
N'-(2-methyl-4-nitrophenyl)-N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]oxamide (PubChem CID 121109828) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is N'-(2-methyl-4-nitrophenyl)-N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2-methyl-4-nitrophenyl)-N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 121109828 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N'-(2-methyl-4-nitrophenyl)-N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]oxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)NCC1CCN(C2CCSC2)CC1 |
| InChI | InChI=1S/C19H26N4O4S/c1-13-10-15(23(26)27)2-3-17(13)21-19(25)18(24)20-11-14-4-7-22(8-5-14)16-6-9-28-12-16/h2-3,10,14,16H,4-9,11-12H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | HLAMJTWPEAGGTI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|