C18H19NO4 — CID 35503747
(3-methylphenyl) 1-(furan-3-carbonyl)piperidine-4-carboxylate (PubChem CID 35503747) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (3-methylphenyl) 1-(furan-3-carbonyl)piperidine-4-carboxylate.
| Compound Name | (3-methylphenyl) 1-(furan-3-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 35503747 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (3-methylphenyl) 1-(furan-3-carbonyl)piperidine-4-carboxylate |
| SMILES | Cc1cccc(OC(=O)C2CCN(C(=O)c3ccoc3)CC2)c1 |
| InChI | InChI=1S/C18H19NO4/c1-13-3-2-4-16(11-13)23-18(21)14-5-8-19(9-6-14)17(20)15-7-10-22-12-15/h2-4,7,10-12,14H,5-6,8-9H2,1H3 |
| InChIKey | ACHCOTKJSKPRJE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|