C21H23NO5 — CID 87011743
[2-methoxy-4-[(E)-prop-1-enyl]phenyl] 1-(furan-3-carbonyl)piperidine-4-carboxylate (PubChem CID 87011743) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 1-(furan-3-carbonyl)piperidine-4-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 1-(furan-3-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 87011743 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 1-(furan-3-carbonyl)piperidine-4-carboxylate |
| SMILES | C/C=C/c1ccc(OC(=O)C2CCN(C(=O)c3ccoc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H23NO5/c1-3-4-15-5-6-18(19(13-15)25-2)27-21(24)16-7-10-22(11-8-16)20(23)17-9-12-26-14-17/h3-6,9,12-14,16H,7-8,10-11H2,1-2H3/b4-3+ |
| InChIKey | WCWLOTIZASAHFD-ONEGZZNKSA-N |
| XLogP | 3.78 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|